Cucurbitacin B
Cucurbitacin B, which can be extracted from the rhizomes of Hemsleya amabilis Diels, has profound in vitro and in vivo antiproliferative effects against human pancreatic cancer cells. Cucurbitacin B inhibits proliferation and induces apoptosis via STAT3 pathway inhibition in A549 lung cancer cells. It is also an effective inhibitor of HIF-1 and provide new perspectives into the mechanism of its anticancer activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7003 |
| Pricing | Inquire |
| Cas | 6199-67-3 |
| Molecular Weight | 558.7 |
| Molecular Formula | C32H46O8 |
| Canonical SMILES | CC(=O)OC(C)(C)C=CC(=O)C(C)(C1C(CC2(C1(CC(=O)C3(C2CC=C4C3CC(C(=O)C4(C)C)O)C)C)C)O)O |