CGP 43182
CGP 43182, a dioxaspiro compound, has been found to a IIA sPLA2 inhibitor that could have potential anti-inflammatory effect and also in influencing the synergistic effect brought by pro-inflammatory genes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 150379-37-6 |
| Pricing | Inquire |
| Cas | 150379-37-6 |
| Molecular Weight | 372.20 |
| Molecular Formula | C16H15Cl2NO5 |
| Canonical SMILES | C1CCC2(CC1)OC(=C(C(=O)O2)C(=O)NC3=C(C(=CC=C3)Cl)Cl)O |