Loureirin B
Loureirin B, isolated from the herbs of Dracaena cochinchinensis, is a channel blocker of Kv1.3 by interacting with amino acid residues in its selective filter region. Direct inhibition of Kv1.3 in T cells by SD and Loureirin B might be the cellular and molecular basis of SD-mediated immunosuppression. Loureirin B could evoke the elevation of [Ca(2+)](i) in a dose-dependent manner. Loureirin B is also the effective component in dragon's blood modulating sodium currents in trigeminal ganglion neurons.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP0990 |
| Pricing | Inquire |
| Cas | 119425-90-0 |
| Molecular Weight | 316.35 |
| Molecular Formula | C18H20O5 |
| Canonical SMILES | COC1=CC(=C(C(=C1)OC)CCC(=O)C2=CC=C(C=C2)O)OC |