Fmoc-4-(Boc-aminomethyl)-L-phenylalanine
| Supplier | Alfa Chemistry |
|---|---|
| Product # | ACM204715913-1 |
| CAS # | 204715-91-3 |
| Pricing | Inquire |
| Synonyms | 4-(Boc-aminomethyl)-Fmoc-phenylalanine, FMOC-L-4-AMINOMETHYLPHENYLALANINE(BOC), FMOC-S-PHE(4-MENHBOC)-OH, FMOC-PHE(4-CH2NHBOC)-OH, REF DUPL: Fmoc-L-Phe(4-CH2NHBoc)-OH, Fmoc-L-(4-amino(Boc)methyl)Phe-OH, Fmoc-L-Phe(4-CH2NHBoc)-OH |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid |
| Purity | Peak Area by HPLC ≥95% |
| MolecularFormula | C30H32N2O6 |
| MolecularWeight | 516.6 |
| Application | Fmoc-4-(Boc-aminomethyl)-L-phenylalanine is widely used in peptide synthesis, particularly in the solid-phase peptide synthesis technique. It can also be used in the synthesis of cyclic peptides and peptidomimetics. Additionally, the compound can be used as a building block for the synthesis of other amino acid derivatives and bioactive molecules. |