Galanin-Like Peptide (human)
Galanin-Like Peptide (GALP), a neuropeptide composed of 60 amino acids, was first isolated from the hypothalamus of pigs and later discovered in rats and humans. GALP shows a higher affinity (about 18-fold) for GALR2 receptors than GALR1 receptors, while galanin is relatively non-selective. GALP is an orexigenic and anxiogenic peptide that can affect the emotional state of the central nervous system.
Supplier | BOC Sciences |
---|---|
Product # | BAT-015324 |
Pricing | Inquire |
Cas | 245114-99-2 |
Molecular Weight | 6500.37 |
Molecular Formula | C292H451N83O84S |
Canonical SMILES | CCC(C)C(C(=O)NC(CC(=O)O)C(=O)NCC(=O)NC(CC(C)C)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CO)C(=O)NC(CC3=CNC=N3)C(=O)N4CCCC4C(=O)N5CCCC5C(=O)NC(CCC(=O)N)C(=O)N6CCCC6C(=O)NC(CO)C(=O)O)NC(=O)C(C)NC(=O)C(CCCCN)NC(=O)C(CC7=CNC8=CC=CC=C87)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(C(C)CC)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C(C)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCCN)NC(=O)CNC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CCSC)NC(=O)C(CCC(=O)N)NC(=O)C9CCCN9C(=O)C(CC(C)C)NC(=O)C(CC1=CNC=N1)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C1CCCN1C(=O)CNC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)CNC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(=O)N)NC(=O)C(CC(C)C)NC(=O)C(C(C)O)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)CNC(=O)CNC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(CCCNC(=N)N)NC(=O)C(CC1=CNC=N1)NC(=O)C(C)NC(=O)C1CCCN1C(=O)C(C)N |