5'-O-TBDMS-2'-deoxyadenosine
5'-O-TBDMS-2'-deoxyadenosine, a synthetic nucleoside derivative, utilized in the manufacturing of anti-cancer agents and antiviral drugs. It also plays a crucial role in gene therapy research and gene expression analyses as an oligonucleotide synthesizing agent. Moreover, this exceptional compound boasts of its remarkable metabolic stability, and is renowned for its potent DNA polymerase and reverse transcriptase inhibitory effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51549-30-5 |
| Pricing | Inquire |
| Cas | 51549-30-5 |
| Molecular Weight | 365.51 |
| Molecular Formula | C16H27N5O3Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C(CC(O1)N2C=NC3=C(N=CN=C32)N)O |