2-Amino-6-chloropurine-9-beta-D-(2'-deoxy-3',5'-di-O-(p-toluoyl))riboside
2-Amino-6-chloropurine-9-beta-D-(2'-deoxy-3',5'-di-O-(p-toluoyl))riboside, a robust nucleoside analog, is recognized for its potent antiviral attributes. By impeding viral replication and fortifying the immune system against infected cells, it displays remarkable efficacy. Its intricate structure and mechanism of action render it an invaluable asset in the pursuit of groundbreaking antiviral research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35095-93-3 |
| Pricing | Inquire |
| Cas | 35095-93-3 |
| Molecular Weight | 521.95 |
| Molecular Formula | C26H24ClN5O5 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C(CC(O2)N3C=NC4=C3N=C(N=C4Cl)N)OC(=O)C5=CC=C(C=C5)C |