D-Alanine 7-amido-4-methylcoumarin trifluoroacetate
D-Alanine 7-amido-4-methylcoumarin trifluoroacetate is a biochemical compound used in the biomedical industry serving as a substrate for enzyme assays, specifically for the detection of various enzymes involved in drug metabolism, such as dehydrogenases and decarboxylases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-001598 |
| Pricing | Inquire |
| Cas | 201847-52-1 |
| Molecular Weight | 360.29 |
| Molecular Formula | C15H15F3N2O5 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(C)N.C(=O)(C(F)(F)F)O |