Valacyclovir-[d4] Hydrochloride
Valacyclovir-[d4] Hydrochloride is the labelled analogue of Valacyclovir Hydrochloride, which is a derivative of valacyclovir. valacyclovir is an antiviral drug used in the management of herpes simplex, herpes zoster and herpes B.
Supplier | BOC Sciences |
---|---|
Product # | BLP-008213 |
Pricing | Inquire |
Cas | 1331910-75-8 |
Molecular Weight | 364.82 |
Molecular Formula | C13H16D4N6O4.HCl |
Canonical SMILES | CC(C)C(C(=O)OCCOCN1C=NC2=C1N=C(NC2=O)N)N.Cl |