5-(1-Propynyl)-2'-O-methylcytidine
5-(1-Propynyl)-2'-O-methylcytidine is a robust and efficacious antiviral compound, finding profound utility in the research of various virological malaises such as respiratory syncytial virus (RSV), influenza and hemorrhagic fever viruses. Its mechanism of action lies in thwarting viral replication and averting viral dissemination within the host organism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 179817-96-0 |
| Pricing | Inquire |
| Cas | 179817-96-0 |
| Molecular Weight | 295.29 |
| Molecular Formula | C13H17N3O5 |
| Canonical SMILES | CC#CC1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)OC |