GNF-7
GNF-7 is a type-II T315I inhibitor. GNF-7 inhibits Ack1 and germinal center kinase (GCK). GNF-7 is among the first type-II inhibitors capable of inhibiting T315I to be described and will serve as a valuable lead to design the third generation Bcr-Abl kinase inhibitors. .
| Supplier | BOC Sciences |
|---|---|
| Product # | 839706-07-9 |
| Pricing | Inquire |
| Cas | 839706-07-9 |
| Molecular Weight | 547.54 |
| Molecular Formula | C28H24F3N7O2 |
| Canonical SMILES | O=C(NC1=CC=C(C)C(N2CC3=CN=C(NC4=CC=C(C)N=C4)N=C3N(C)C2=O)=C1)C5=CC=CC(C(F)(F)F)=C5 |