LDN-193189 HCl
LDN193189 HCl is the hydrochloride salt of LDN193189, which is a selective BMP signaling inhibitor, and inhibits the transcriptional activity of the BMP type I receptors ALK2 and ALK3 with IC50 of 5 nM and 30 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-456763 |
| Pricing | Inquire |
| Cas | 1062368-62-0 |
| Molecular Weight | 442.94 |
| Molecular Formula | C25H22N6.HCl |
| Canonical SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=CN4C(=C(C=N4)C5=CC=NC6=CC=CC=C56)N=C3.Cl |