D-Glucoheptonic acid sodium salt dihydrate
D-Glucoheptonic acid sodium salt dihydrate is an indispensable compound acting as not only an intermediary catalyst but also a key excipient and recompound within the biomedical industry. It can be used to revolutionize drug progression within the context of diabetes, metabolic disorders and their affiliated maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31138-65-5 |
| Pricing | Inquire |
| Cas | 31138-65-5 |
| Molecular Weight | 248.16 |
| Molecular Formula | C7H13O8Na |
| Canonical SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |