2,6-Diamino-9-(2'-amino-2'-deoxy-b-D-ribofuranosyl)purine
2,6-Diamino-9-(2'-amino-2'-deoxy-b-D-ribofuranosyl)purine, known for its intricate molecular composition, serves as a compelling and influential bioactive agent within the biomedical realm. Notably harnessed in the advancement of antiviral medications specifically designed to impede viral DNA or RNA synthesis, this compound displays immense potential in combating various ailments triggered by viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 215943-79-6 |
| Pricing | Inquire |
| Cas | 215943-79-6 |
| Molecular Weight | 281.28 |
| Molecular Formula | C10H15N7O3 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)N)N)N |