Brompheniramine-[d4]
Brompheniramine-[d4], is the labelled analogue of Brompheniramine. Brompheniramine is an antihistamine drug of the propylamine class. It is indicated for the treatment of the symptoms of the common cold and allergic rhinitis, such as runny nose, itchy eyes, watery eyes, and sneezing.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002106 |
| Pricing | Inquire |
| Cas | 1432061-62-5 |
| Molecular Weight | 323.26 |
| Molecular Formula | C16H15D4BrN2 |
| Canonical SMILES | CN(C)CCC(C1=CC=C(C=C1)Br)C2=CC=CC=N2 |