b-D-Lactosyltrichloroacetimidate heptaacetate
b-D-Lactosyltrichloroacetimidate heptaacetate is a crucial compound widely used in the biomedical industry. It serves as a versatile reagent for carbohydrate chemistry. This product facilitates the synthesis of various biologically active compounds, polysaccharides, and glycoconjugates. Its applications include drug development, targeting diseases like cancer, neurodegenerative disorders, and infectious diseases. With its exceptional properties, b-D-Lactosyltrichloroacetimidate heptaacetate plays a significant role in advancing biomedical research and therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1142022-76-1 |
| Pricing | Inquire |
| Cas | 1142022-76-1 |
| Molecular Weight | 780.94 |
| Molecular Formula | C28H36Cl3NO18 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |