Formamide,N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Formamide, N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]- is an extensively employed compound in the field of biomedicine. With its profound involvement in the critical facets of target validation and drug discovery encompassing diverse ailments, this compound assumes paramount importance. Its presence undeniably contributes to the exploration, identification, and appraisal of potential pharmaceutical agents and therapeutic techniques, thereby fostering advancements in medicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 480425-37-4 |
| Pricing | Inquire |
| Cas | 480425-37-4 |
| Molecular Weight | 247.1 |
| Molecular Formula | C13H18 B N O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC=O |