2-Amino-6-chloro-9-(3-deoxy-3-fluoro-beta-D-ribofuranosyl)-9H-purine
2-Amino-6-chloro-9-(3-deoxy-3-fluoro-beta-D-ribofuranosyl)-9H-purine, an exceptional antiviral compound, stands as a formidable solution in combating diverse viral afflictions. Its profound effectiveness materializes against distinct strains of influenza A and B viruses alongside herpes simplex virus and varicella-zoster virus. Unfolding its therapeutic prowess primarily through the selective obstruction of viral RNA synthesis, this compound emerges as a prized asset within the realm of biomedicine - an indispensable weapon empowering the battle against viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612192-05-8 |
| Pricing | Inquire |
| Cas | 1612192-05-8 |
| Molecular Weight | 303.68 |
| Molecular Formula | C10H11ClFN5O3 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)F)O)N=C(N=C2Cl)N |