MID-1
MID-1 is a disruptor of the interaction of MG53-IRS-1 (Mitsugumin 53-insulin receptor substrate-1). MID-1 disrupts the molecular association between MG53 with IRS-1 and eliminates MG53-induced IRS-1 ubiquitination and degradation in skeletal muscle, resulting in increased IRS-1 expression level, insulin signaling and glucose uptake.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312608-54-1 |
| Pricing | Inquire |
| Cas | 312608-54-1 |
| Molecular Weight | 293.30 |
| Molecular Formula | C12H11N3O4S |
| Canonical SMILES | CCOC1=CC=C(C=C1)C(=O)NC2=NC=C(S2)[N+](=O)[O-] |