Potassium 2-methoxyphenyltrifluoroborate
Potassium 2-methoxyphenyltrifluoroborate is a crucial entity extensively employed within the biomedical sector and manifests as a paramount compound for the synthesis of pharmaceutical agents, specifically designed to tackle distinct maladies. Its inherent adaptability facilitates the creation of remedies to combat diverse afflictions encompassing oncological, cardiac, and neurological impediments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 236388-46-8 |
| Pricing | Inquire |
| Cas | 236388-46-8 |
| Molecular Weight | 214.03 |
| Molecular Formula | CH3OC6H4BF3K |
| Canonical SMILES | [B-](C1=CC=CC=C1OC)(F)(F)F.[K+] |