5-O-(2-Amino-2-deoxy-b-D-glucopyranosyl)-uridine
5-O-(2-Amino-2-deoxy-b-D-glucopyranosyl)-uridine is a captivating bioactive compound, used for research of diverse ailments encompassing viral afflictions and carcinogenic manifestations. Its multifaceted properties, entailing both antiviral and antitumor functionalities, position it as an auspicious contender propelling drug discovery efforts and biomedical investigations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 631842-22-3 |
| Pricing | Inquire |
| Cas | 631842-22-3 |
| Molecular Weight | 405.36 |
| Molecular Formula | C15H23N3O10 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)N)O)O |