Antibiotic A-269A
It is a streptomycin antibiotic produced by the strain of Streptomyces sp. No. A-269. It mainly has the activity against gram-negative bacteria including Escherichia coli and common proteus with MIC (μg/mL) of 1 and 5, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03035 |
| Pricing | Inquire |
| Cas | 38621-52-2 |
| Molecular Weight | 459.46 |
| Molecular Formula | C17H29N7O8 |
| Canonical SMILES | CNCC(=O)N(C)C1C(C(C(OC1NC2=NC3C(N2)C(CNC3=O)O)CO)OC(=O)N)O |