Polyguluronic acid
Polyguluronic acid is an extensively employed biopolymer in the biomedical sector, playing a pivotal role in fabricating drug delivery systems. Its exceptional attributes embrace commendable biocompatibility and biodegradability, rendering it an auspicious contender in the realms of controlled pharmaceutical discharge and tissue engineering ventures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36562-70-6 |
| Pricing | Inquire |
| Cas | 36562-70-6 |
| Molecular Weight | 194.14 |
| Molecular Formula | C6H10O7 |
| Canonical SMILES | C(=O)C(C(C(C(C(=O)O)O)O)O)O |