(1R,1'S,3'R/1R,1'R,3'S)-L-054,264
(1R,1'S,3'R/1R,1'R,3'S)-L-054,264 is a selective and potent somatostatin sst2 receptor agonist with Ki value of 4nm. Its Ki values are 537, 3614, 2480 and 5017 nM for cloned human sst1, sst3, sst4 and sst5 receptors respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 208706-12-1 |
| Pricing | Inquire |
| Cas | 208706-12-1 |
| Molecular Weight | 539.71 |
| Molecular Formula | C33H41N5O2 |
| Canonical SMILES | C1CC(CC(C1)CNC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)N4CCC5(CC4)C=CC6=CC=CC=C56)CN |