1,2,3,6-Tetra-O-benzyl-b-D-galactopyranoside
1,2,3,6-Tetra-O-benzyl-b-D-galactopyranoside, a highly significant chemical compound extensively employed in the biomedical industry, stands as an indispensable instrument for the advancement of pharmaceuticals and investigations. Embracing a pivotal role in the amalgamation of glycosides and glycoconjugates, this compound facilitates the exploration of drug and vaccine possibilities revolving around carbohydrates.
| Supplier | BOC Sciences |
|---|---|
| Product # | 57783-81-0 |
| Pricing | Inquire |
| Cas | 57783-81-0 |
| Molecular Weight | 540.65 |
| Molecular Formula | C34H36O6 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)O |