N4-Ac-C-(S)-GNA phosphoramidite
N4-Ac-C-(S)-GNA phosphoramidite- a paramount ingredient utilized in the synthesis of nucleic acids and their analogs- holds significant potential as a therapeutic agent for a plethora of viral diseases including but not limited to coronavirus, influenza, and HIV. Additionally, it finds relevance in the research concerning genetic engineering and gene therapy - substantially empowering cutting-edge biosciences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1159174-80-7 |
| Pricing | Inquire |
| Cas | 1159174-80-7 |
| Molecular Weight | 729.8 |
| Molecular Formula | C39H48N5O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC(CN1C=CC(=NC1=O)NC(=O)C)COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |