5-Bromo-4-chloro-3-indolyl b-D-fucopyranoside
5-Bromo-4-chloro-3-indolyl b-D-fucopyranoside, a ubiquitous substrate in molecular and cell biology, is utilized as a tool to indicate the presence of beta-galactosidase in the targeted cells. Upon cleavage by the enzyme, the formerly dormant substrate induces a conspicuously blue hue that unmistakably confirms gene expression and sheds light on cellular localization.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17016-46-5 |
| Pricing | Inquire |
| Cas | 17016-46-5 |
| Molecular Weight | 392.63 |
| Molecular Formula | C14H15BrClNO5 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |