L-Glycero-L-galacto-heptose
L-Glycero-L-galacto-heptose is a crucial compound used for various applications. It plays a significant role in the development of potential drugs to study chronic diseases like cancer and diabetes. Additionally, its unique properties make it a key ingredient in the production of vaccines, assisting in enhancing their effectiveness.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20585-65-3 |
| Pricing | Inquire |
| Cas | 20585-65-3 |
| Molecular Weight | 210.18 |
| Molecular Formula | C7H14O7 |
| Canonical SMILES | C(C(C(C(C(C(C=O)O)O)O)O)O)O |