Somatostatin-14 (3-14)
Somatostatin-14 (3-14) is an exquisite peptide analog harnessed extensively for biomedical research, epitomizes a remarkable resemblance to the native hormone somatostatin. Exerting its influence as an agonist dedicated to specific somatostatin receptors, this product exudes exquisite potential in unveiling the intricacies of ailments such as acromegaly, carcinoid syndrome and pancreatic neuroendocrine tumors, all intertwined with the enigmatic somatostatin receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015105 |
| Pricing | Inquire |
| Cas | 54518-51-3 |
| Molecular Weight | 1509.77 |
| Molecular Formula | C71H96N16O17S2 |
| Canonical SMILES | CC(C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=CC=C4)CC5=CC=CC=C5)CC(=O)N)CCCCN)N)C(=O)O)CO)C(C)O)CC6=CC=CC=C6)O |