10-Camphorsulfonyl chloride
10-Camphorsulfonyl chloride (CAS# 4552-50-5) is used as a the starting material in the synthesis of 10-Camphorsulfonic Acid Ethyl Ester (C175040). It is also used as a reagent in the synthesis of 1-benzhydrylpiperazine derivatives which can exhibit antiproliferative activity in vitro against human cancer cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4552-50-5 |
| Pricing | Inquire |
| Cas | 4552-50-5 |
| Molecular Weight | 250.74 |
| Molecular Formula | C10H15ClO3S |
| Canonical SMILES | CC1(C2CCC1(C(=O)C2)CS(=O)(=O)Cl)C |