Tr-PEG2-OH
Tr-PEG2-OH is a PROTAC linker (belonging to the PEG class) that can be used to synthesize PROTAC molecules. Tr-PEG2-OH is also a non-cleavable 2-unit PEG ADC linker that is used in the synthesis of antibody-conjugated drugs (ADCs).
Supplier | BOC Sciences |
---|---|
Product # | BADC-00880 |
Pricing | Inquire |
Cas | 105589-77-3 |
Molecular Weight | 348.44 |
Molecular Formula | C23H24O3 |
Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCCOCCO |