Emodin-[d4]
Emodin-[d4] is the labelled analogue of Emodin, which is an anthraquinone found naturally in the roots and barks of numerous plants. It exerts antiproliferative effects in cancer cells that are regulated by different signaling pathways. It has anti-cancer, anti-depressant and anti-microbial effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-010798 |
| Pricing | Inquire |
| Cas | 132796-52-2 |
| Molecular Weight | 274.26 |
| Molecular Formula | C15H6D4O5 |
| Canonical SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)O |