5-(3-Amino-1-propen-1-yl)-2'-deoxyuridine
5-(3-Amino-1-propen-1-yl)-2'-deoxyuridine, a potent chemotherapeutic agent against multiple types of cancer, works by inducing apoptosis and inhibiting DNA synthesis in malignant cells. Its active ingredient thwarts thymidylate synthase, blocking thymidine production and ultimately halting replication, stopping cancer in its tracks. This widely-used nucleoside treatment targets advanced cases of colon, ovarian, and breast cancer with remarkable success.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143908-73-0 |
| Pricing | Inquire |
| Cas | 143908-73-0 |
| Molecular Weight | 283.28 |
| Molecular Formula | C12H17N3O5 |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)C=CCN)CO)O |