2'-Deoxy-5'-O-DMT-guanosine
2'-Deoxy-5'-O-DMT-guanosine is a remarkable biomedical compound, showcases immense potential in the realm of antiviral drug development. With its intricate chemical composition, this compound serves as a valuable precursor for synthesizing guanosine analogues which effectively impede viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81144-43-6 |
| Pricing | Inquire |
| Cas | 81144-43-6 |
| Molecular Weight | 569.61 |
| Molecular Formula | C31H31N5O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=NC6=C5N=C(NC6=O)N)O |