1-O-Acetyl-2-O-benzoyl-3-O-tert-butyldiphenylsilyl-L-threofuranose
1-OAcetyl-2-O-benzoyl-3-O-tert-butyldiphenylsilyl-L-threofuranose is a key intermediate in the synthesis of nucleoside analogues used as antiviral drugs to treat infections such as HIV, hepatitis B and C. It is also used in the synthesis of various inhibitors for cancer treatment.
Supplier | BOC Sciences |
---|---|
Product # | 1971879-01-2 |
Pricing | Inquire |
Cas | 1971879-01-2 |
Molecular Weight | 504.65 |
Molecular Formula | C29H32O6Si |
Canonical SMILES | CC(=O)OC1C(C(CO1)O[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C(C)(C)C)OC(=O)C4=CC=CC=C4 |