4-Bromo-A23187
4-Bromo-calcimycin, a halogenated analog of A-2318, is a non-fluorescent Ca2+ ionophore which could be commonly used in fluorescent probes experiments as a modutor of the quantitation of free Ca2+. Nonfluorescent calcium ionophore used as a calibration standard for determining cytoplasmic calcium ions by fluorescent probes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76455-48-6 |
| Pricing | Inquire |
| Cas | 76455-48-6 |
| Molecular Weight | 602.50 |
| Molecular Formula | C29H36BrN3O6 |
| Canonical SMILES | CC1CCC2(C(CC(C(O2)C(C)C(=O)C3=CC=CN3)C)C)OC1CC4=NC5=C(C(=C(C=C5O4)Br)NC)C(=O)O |