1,3:1,4 b-Glucotetraose (C)
1,3:1,4 b-Glucotetraose (C) is a tetrasaccharide linked by β-1,3 and β-1,4 glycosidic bonds. It is often used in studying carbohydrate metabolism and has digestive enzyme functions, which can aid in understanding interventions for metabolic disorders such as diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103762-93-2 |
| Pricing | Inquire |
| Cas | 103762-93-2 |
| Molecular Weight | 666.58 |
| Molecular Formula | C24H42O21 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3O)OC(C(CO)O)C(C(C=O)O)O)CO)O)CO)O)O)O)O |