4-Trifluoromethylumbelliferyl b-D-galactopyranoside
4-Trifluoromethylumbelliferyl b-D-galactopyranoside is a compound utilized in the study of enzyme activity and molecular biology techniques. It actis as a substrate for the detection and measurement of β-galactosidase activity. This compound is particularly useful in the research of certain diseases associated with defective galactosidase enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 117153-55-6 |
| Pricing | Inquire |
| Cas | 117153-55-6 |
| Molecular Weight | 392.28 |
| Molecular Formula | C16H16F3O8 |
| Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C=C2C(F)(F)F |