3-Methoxybenzylzinc chloride solution
3-Methoxybenzylzinc chloride solution is a powerful and versatile reagent used in the biomedical industry for various applications. It is commonly employed in the synthesis of organic compounds, including pharmaceutical intermediates and drug molecules. With its ability to react with various functional groups, this solution proves beneficial in the development of drugs targeting specific diseases, such as cancer and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312693-16-6 |
| Pricing | Inquire |
| Cas | 312693-16-6 |
| Molecular Weight | 222.00 |
| Molecular Formula | CH3OC6H4CH2ZnCl |
| Canonical SMILES | COC1=CC=CC(=C1)[CH2-].Cl[Zn+] |