3'-Amino-2',3'-dideoxycytidine
3'-Amino-2',3'-dideoxycytidine, a highly potent antiviral agent, finds extensive application in combating viral infections, especially HIV/AIDS. By impeding viral reverse transcriptase activity, it effectively thwarts viral multiplication and diminishes viral burden. Its exceptional mode of action entails the curtailment of elongating DNA strands during viral replication, leading to a significant decline in viral infectivity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84472-90-2 |
| Pricing | Inquire |
| Cas | 84472-90-2 |
| Molecular Weight | 226.23 |
| Molecular Formula | C9H14N4O3 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)CO)N |