2-Deoxy-D-glucose-6-phosphate
2-Deoxy-D-glucose-6-phosphate is an exquisite biochemical compound with prowess lying in the formidable suppression of glucose metabolism and cellular proliferation, thereby rendering it a promising harbinger for the research of specifically targeting malignant neoplasms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3573-50-0 |
| Pricing | Inquire |
| Cas | 3573-50-0 |
| Molecular Weight | 244.14 |
| Molecular Formula | C6H13O8P |
| Canonical SMILES | C(C=O)C(C(C(COP(=O)(O)O)O)O)O |