(Rac)-PF-998425
(Rac)-PF-998425 is a potent, selective, nonsteroidal androgen receptor (AR) antagonist. (Rac)-PF-998425 has IC50 values of 26 and 90 nM in the AR binding and cellular assays, respectively. It also has the potential for the research of the androgenetic alopecia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1076225-26-7 |
| Pricing | Inquire |
| Cas | 1076225-26-7 |
| Molecular Weight | 269.26 |
| Molecular Formula | C14H14F3NO |
| Canonical SMILES | C1CCC(C(C1)C2=CC(=C(C=C2)C#N)C(F)(F)F)O |