Clotrimazole Impurity B
para-Clotrimazole Isomer is a positional isomer of the antifungal agent. It showed agonistic activity on the pregnane X receptor and regulated the levels of apoA1 and HDL-cholesterol in rodents.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-469288 |
| Pricing | Inquire |
| Cas | 23593-71-7 |
| Molecular Weight | 344.84 |
| Molecular Formula | C22H17ClN2 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)Cl)N4C=CN=C4 |