2-Fluoro-3-(trifluoromethyl)benzoyl chloride
2-Fluoro-3-(trifluoromethyl)benzoyl chloride (CAS# 208173-19-7) is a building block used for the synthesis of more complex pharmaceutical and biologically active compounds. It can be used for the synthesis of highly potent novel ketoamide-based cathepsin S inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 208173-19-7 |
| Pricing | Inquire |
| Cas | 208173-19-7 |
| Molecular Weight | 226.56 |
| Molecular Formula | C8H3ClF4O |
| Canonical SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl |