D-Glucose-6-phosphate monosodium salt
D-Glucose-6-phosphate monosodium salt is an indispensable chemical compound, exerting paramount significance in multifarious biochemical reactions, especially within the glycolysis pathway. It has broad application in the study and investigation of metabolic disorders, such as glycogen storage diseases and glucose-6-phosphate dehydrogenase deficiencies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 54010-71-8 |
| Pricing | Inquire |
| Cas | 54010-71-8 |
| Molecular Weight | 282.12 |
| Molecular Formula | C6H12NaO9P |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)OP(=O)(O)[O-].[Na+] |