WSP-1
WSP-1 is a fluorescent probe designed to monitor H2S in biological samples and cells. Through a reaction-based fluorescent turn-on strategy, WSP-1 selectively and rapidly reacts with H2S to generate benzodithiolone and a fluorophore with excitation and emission maxima of 465 and 515 nm, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1352750-34-5 |
| Pricing | Inquire |
| Cas | 1352750-34-5 |
| Molecular Weight | 591.7 |
| Molecular Formula | C33H21NO6S2 |
| Canonical SMILES | COC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C5=CC=CC=C5SSC6=CC=CC=N6)C7=CC=CC=C7C(=O)O3 |