Ticagrelor Impurity L
An impurity of Ticagrelor which is a reversible P2Y12 receptor antagonist and is unique in its greater and more rapid and consistent, yet reversible, inhibition of the ADP receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1644461-85-7 |
| Pricing | Inquire |
| Cas | 1644461-85-7 |
| Molecular Weight | 538.57 |
| Molecular Formula | C23H28F2N6O5S |
| Canonical SMILES | CCCS(=O)C1=NC(=C2C(=N1)N(N=N2)C3CC(C(C3O)O)OCCO)NC4CC4C5=CC(=C(C=C5)F)F |