Rebaudioside D
Rebaudioside D is extracted from the leaves of Stevia rebaudiana Bertoni. It is a potential sweetener. It showed similar stability when exposed to simulated stomach and small intestine fluids, with susceptibility to hydrolytic degradation by enteric bacteria collected from the cecum.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-003552 |
| Pricing | Inquire |
| Cas | 63279-13-0 |
| Molecular Weight | 1129.15 |
| Molecular Formula | C50H80O28 |
| Canonical SMILES | CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)OC5C(C(C(C(O5)CO)O)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)(C)C(=O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)CO)O)O)O |