2'-O-Acetyl-5'-O-benzoyl-5-methyl-3'-deoxyuridine
2'-O-Acetyl-5'-O-benzoyl-5-methyl-3'-deoxyuridine, renowned in biomedicine, assumes a critical role as a foundational element for crafting antiviral agents. Notably, this compound amplifies the efficacy of medicinal solutions aimed at combating pernicious viral afflictions like herpes and hepatitis. Its unparalleled architecture and distinctive attributes render it an indispensable building block for pioneering pharmacological interventions targeting these virulent maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143653-60-5 |
| Pricing | Inquire |
| Cas | 143653-60-5 |
| Molecular Weight | 388.37 |
| Molecular Formula | C19H20N2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(CC(O2)COC(=O)C3=CC=CC=C3)OC(=O)C |