(3S,5S)-[6]-Gingerdiol
(3S,5S)-[6]-Gingerdiol is a remarkable natural compound product unveiling its multifaceted potential in studying a myriad of diseases. With its unique pharmacological profile boasting anti-inflammatory is anti-cancer and antioxidant effects, this natural compound stands as a promising contender in studying ailments linked to cancer, inflammation and oxidative stress.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4935 |
| Pricing | Inquire |
| Cas | 143615-76-3 |
| Molecular Weight | 296.40 |
| Molecular Formula | C17H28O4 |
| Canonical SMILES | CCCCCC(CC(CCC1=CC(=C(C=C1)O)OC)O)O |